C17H25N3OSSe — CID 71770245
N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-5-(thiaselenolan-3-yl)pentanamide (PubChem CID 71770245) has the molecular formula C17H25N3OSSe and a molecular weight of 398.43 g/mol. Its IUPAC name is N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-5-(thiaselenolan-3-yl)pentanamide.
| Compound Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-5-(thiaselenolan-3-yl)pentanamide |
|---|---|
| PubChem CID | 71770245 |
| Molecular Formula | C17H25N3OSSe |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-5-(thiaselenolan-3-yl)pentanamide |
| SMILES | CN(C)c1ccc(/C=N/NC(=O)CCCCC2CCS[Se]2)cc1 |
| InChI | InChI=1S/C17H25N3OSSe/c1-20(2)15-9-7-14(8-10-15)13-18-19-17(21)6-4-3-5-16-11-12-22-23-16/h7-10,13,16H,3-6,11-12H2,1-2H3,(H,19,21)/b18-13+ |
| InChIKey | TUJNXTUMQXKBOB-QGOAFFKASA-N |
| XLogP | 3.31 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|