C21H25N5O3 — CID 171981399
N-(4-acetamidophenyl)-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]butanediamide (PubChem CID 171981399) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]butanediamide.
| Compound Name | N-(4-acetamidophenyl)-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]butanediamide |
|---|---|
| PubChem CID | 171981399 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-(4-acetamidophenyl)-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]butanediamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CCC(=O)N/N=C/c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H25N5O3/c1-15(27)23-17-6-8-18(9-7-17)24-20(28)12-13-21(29)25-22-14-16-4-10-19(11-5-16)26(2)3/h4-11,14H,12-13H2,1-3H3,(H,23,27)(H,24,28)(H,25,29)/b22-14+ |
| InChIKey | VCXHRNTXKVMPOW-HYARGMPZSA-N |
| XLogP | 2.58 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|