C31H30N4O3S — CID 21229803
3-[[(E)-anthracen-9-ylmethylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide (PubChem CID 21229803) has the molecular formula C31H30N4O3S and a molecular weight of 538.67 g/mol. Its IUPAC name is 3-[[(E)-anthracen-9-ylmethylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide.
| Compound Name | 3-[[(E)-anthracen-9-ylmethylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 21229803 |
| Molecular Formula | C31H30N4O3S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 3-[[(E)-anthracen-9-ylmethylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide |
| SMILES | O=C(CCN(/N=C/c1c2ccccc2cc2ccccc12)C1=NS(=O)(=O)c2ccccc21)NC1CCCCC1 |
| InChI | InChI=1S/C31H30N4O3S/c36-30(33-24-12-2-1-3-13-24)18-19-35(31-27-16-8-9-17-29(27)39(37,38)34-31)32-21-28-25-14-6-4-10-22(25)20-23-11-5-7-15-26(23)28/h4-11,14-17,20-21,24H,1-3,12-13,18-19H2,(H,33,36)/b32-21+ |
| InChIKey | GRKJBILFVOXUMS-RUMWWMSVSA-N |
| XLogP | 5.62 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|