C27H28N3O4S+ — CID 4049094
[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-2-(piperidin-1-ium-1-ylmethyl)phenyl] 4-methylbenzoate (PubChem CID 4049094) has the molecular formula C27H28N3O4S+ and a molecular weight of 490.61 g/mol. Its IUPAC name is [4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-2-(piperidin-1-ium-1-ylmethyl)phenyl] 4-methylbenzoate.
| Compound Name | [4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-2-(piperidin-1-ium-1-ylmethyl)phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 4049094 |
| Molecular Formula | C27H28N3O4S+ |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | [4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-2-(piperidin-1-ium-1-ylmethyl)phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(NC3=NS(=O)(=O)c4ccccc43)cc2C[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C27H27N3O4S/c1-19-9-11-20(12-10-19)27(31)34-24-14-13-22(17-21(24)18-30-15-5-2-6-16-30)28-26-23-7-3-4-8-25(23)35(32,33)29-26/h3-4,7-14,17H,2,5-6,15-16,18H2,1H3,(H,28,29)/p+1 |
| InChIKey | NDKAUZRJEQJDDE-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|