C22H17NO5S — CID 7697607
N-[(2-methoxyphenyl)methyl]-9,10,10-trioxothioxanthene-3-carboxamide (PubChem CID 7697607) has the molecular formula C22H17NO5S and a molecular weight of 407.45 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-9,10,10-trioxothioxanthene-3-carboxamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-9,10,10-trioxothioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 7697607 |
| Molecular Formula | C22H17NO5S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-9,10,10-trioxothioxanthene-3-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H17NO5S/c1-28-18-8-4-2-6-15(18)13-23-22(25)14-10-11-17-20(12-14)29(26,27)19-9-5-3-7-16(19)21(17)24/h2-12H,13H2,1H3,(H,23,25) |
| InChIKey | YSFWSKNKMSGSFV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |