C26H26N2O4S — CID 42907256
N-[2-(diethylamino)-2-phenylethyl]-9,10,10-trioxothioxanthene-3-carboxamide (PubChem CID 42907256) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-phenylethyl]-9,10,10-trioxothioxanthene-3-carboxamide.
| Compound Name | N-[2-(diethylamino)-2-phenylethyl]-9,10,10-trioxothioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 42907256 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-[2-(diethylamino)-2-phenylethyl]-9,10,10-trioxothioxanthene-3-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O4S/c1-3-28(4-2)22(18-10-6-5-7-11-18)17-27-26(30)19-14-15-21-24(16-19)33(31,32)23-13-9-8-12-20(23)25(21)29/h5-16,22H,3-4,17H2,1-2H3,(H,27,30) |
| InChIKey | CRVUPKSDGVTHGK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |