C23H19NO4 — CID 55577076
N-[(2,4-dimethoxyphenyl)methyl]-9-oxofluorene-2-carboxamide (PubChem CID 55577076) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-9-oxofluorene-2-carboxamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-9-oxofluorene-2-carboxamide |
|---|---|
| PubChem CID | 55577076 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-9-oxofluorene-2-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc3c(c2)C(=O)c2ccccc2-3)c(OC)c1 |
| InChI | InChI=1S/C23H19NO4/c1-27-16-9-7-15(21(12-16)28-2)13-24-23(26)14-8-10-18-17-5-3-4-6-19(17)22(25)20(18)11-14/h3-12H,13H2,1-2H3,(H,24,26) |
| InChIKey | KCQTYZMUUSXOOW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |