C19H17NO4S — CID 7962238
N-cyclopentyl-9,10,10-trioxothioxanthene-3-carboxamide (PubChem CID 7962238) has the molecular formula C19H17NO4S and a molecular weight of 355.41 g/mol. Its IUPAC name is N-cyclopentyl-9,10,10-trioxothioxanthene-3-carboxamide.
| Compound Name | N-cyclopentyl-9,10,10-trioxothioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 7962238 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-cyclopentyl-9,10,10-trioxothioxanthene-3-carboxamide |
| SMILES | O=C(NC1CCCC1)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H17NO4S/c21-18-14-7-3-4-8-16(14)25(23,24)17-11-12(9-10-15(17)18)19(22)20-13-5-1-2-6-13/h3-4,7-11,13H,1-2,5-6H2,(H,20,22) |
| InChIKey | YENGDVGEQVWORF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |