C19H12N2O4S — CID 2331607
9,10,10-trioxo-N-pyridin-2-ylthioxanthene-3-carboxamide (PubChem CID 2331607) has the molecular formula C19H12N2O4S and a molecular weight of 364.38 g/mol. Its IUPAC name is 9,10,10-trioxo-N-pyridin-2-ylthioxanthene-3-carboxamide.
| Compound Name | 9,10,10-trioxo-N-pyridin-2-ylthioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 2331607 |
| Molecular Formula | C19H12N2O4S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 9,10,10-trioxo-N-pyridin-2-ylthioxanthene-3-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H12N2O4S/c22-18-13-5-1-2-6-15(13)26(24,25)16-11-12(8-9-14(16)18)19(23)21-17-7-3-4-10-20-17/h1-11H,(H,20,21,23) |
| InChIKey | IZSHJOFFJKJELW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |