C16H10N4O4S — CID 2306951
9,10,10-trioxo-N-(1H-1,2,4-triazol-5-yl)thioxanthene-3-carboxamide (PubChem CID 2306951) has the molecular formula C16H10N4O4S and a molecular weight of 354.35 g/mol. Its IUPAC name is 9,10,10-trioxo-N-(1H-1,2,4-triazol-5-yl)thioxanthene-3-carboxamide.
| Compound Name | 9,10,10-trioxo-N-(1H-1,2,4-triazol-5-yl)thioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 2306951 |
| Molecular Formula | C16H10N4O4S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 9,10,10-trioxo-N-(1H-1,2,4-triazol-5-yl)thioxanthene-3-carboxamide |
| SMILES | O=C(Nc1ncn[nH]1)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H10N4O4S/c21-14-10-3-1-2-4-12(10)25(23,24)13-7-9(5-6-11(13)14)15(22)19-16-17-8-18-20-16/h1-8H,(H2,17,18,19,20,22) |
| InChIKey | GWMFBPFDMQQTHL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |