C20H20N2O4S — CID 119601979
N-[2-(aminomethyl)cyclopentyl]-9,10,10-trioxothioxanthene-3-carboxamide (PubChem CID 119601979) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-9,10,10-trioxothioxanthene-3-carboxamide.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-9,10,10-trioxothioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 119601979 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-9,10,10-trioxothioxanthene-3-carboxamide |
| SMILES | NCC1CCCC1NC(=O)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H20N2O4S/c21-11-13-4-3-6-16(13)22-20(24)12-8-9-15-18(10-12)27(25,26)17-7-2-1-5-14(17)19(15)23/h1-2,5,7-10,13,16H,3-4,6,11,21H2,(H,22,24) |
| InChIKey | MOYOWMAEENOLOO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |