C20H20N2O4S — CID 120555324
N-(3-methylpiperidin-4-yl)-9,10,10-trioxothioxanthene-3-carboxamide (PubChem CID 120555324) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is N-(3-methylpiperidin-4-yl)-9,10,10-trioxothioxanthene-3-carboxamide.
| Compound Name | N-(3-methylpiperidin-4-yl)-9,10,10-trioxothioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 120555324 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-(3-methylpiperidin-4-yl)-9,10,10-trioxothioxanthene-3-carboxamide |
| SMILES | CC1CNCCC1NC(=O)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H20N2O4S/c1-12-11-21-9-8-16(12)22-20(24)13-6-7-15-18(10-13)27(25,26)17-5-3-2-4-14(17)19(15)23/h2-7,10,12,16,21H,8-9,11H2,1H3,(H,22,24) |
| InChIKey | WGDOOAGOZWJEEJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |