C22H24ClN3O3 — CID 120557136
3-[(1,3-dioxoisoindol-2-yl)methyl]-N-(3-methylpiperidin-4-yl)benzamide;hydrochloride (PubChem CID 120557136) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-(3-methylpiperidin-4-yl)benzamide;hydrochloride.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-(3-methylpiperidin-4-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120557136 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-(3-methylpiperidin-4-yl)benzamide;hydrochloride |
| SMILES | CC1CNCCC1NC(=O)c1cccc(CN2C(=O)c3ccccc3C2=O)c1.Cl |
| InChI | InChI=1S/C22H23N3O3.ClH/c1-14-12-23-10-9-19(14)24-20(26)16-6-4-5-15(11-16)13-25-21(27)17-7-2-3-8-18(17)22(25)28;/h2-8,11,14,19,23H,9-10,12-13H2,1H3,(H,24,26);1H |
| InChIKey | ORDHXURXZCCCKH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|