C19H19ClN2O4S — CID 119425718
9,10,10-trioxo-N-piperidin-3-ylthioxanthene-3-carboxamide;hydrochloride (PubChem CID 119425718) has the molecular formula C19H19ClN2O4S and a molecular weight of 406.89 g/mol. Its IUPAC name is 9,10,10-trioxo-N-piperidin-3-ylthioxanthene-3-carboxamide;hydrochloride.
| Compound Name | 9,10,10-trioxo-N-piperidin-3-ylthioxanthene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119425718 |
| Molecular Formula | C19H19ClN2O4S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 9,10,10-trioxo-N-piperidin-3-ylthioxanthene-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCCNC1)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H18N2O4S.ClH/c22-18-14-5-1-2-6-16(14)26(24,25)17-10-12(7-8-15(17)18)19(23)21-13-4-3-9-20-11-13;/h1-2,5-8,10,13,20H,3-4,9,11H2,(H,21,23);1H |
| InChIKey | XBXZNZYLHXPXQK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |