C20H19ClN2O3 — CID 9321369
N-[(2-chlorophenyl)methyl]-2-(2-methylpropyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 9321369) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(2-methylpropyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(2-methylpropyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 9321369 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(2-methylpropyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CC(C)CN1C(=O)c2ccc(C(=O)NCc3ccccc3Cl)cc2C1=O |
| InChI | InChI=1S/C20H19ClN2O3/c1-12(2)11-23-19(25)15-8-7-13(9-16(15)20(23)26)18(24)22-10-14-5-3-4-6-17(14)21/h3-9,12H,10-11H2,1-2H3,(H,22,24) |
| InChIKey | GZFDFROQIZEEMW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|