C22H20F3N3O4 — CID 108934439
2-(2-methylpropyl)-1,3-dioxo-N-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]isoindole-5-carboxamide (PubChem CID 108934439) has the molecular formula C22H20F3N3O4 and a molecular weight of 447.41 g/mol. Its IUPAC name is 2-(2-methylpropyl)-1,3-dioxo-N-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]isoindole-5-carboxamide.
| Compound Name | 2-(2-methylpropyl)-1,3-dioxo-N-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 108934439 |
| Molecular Formula | C22H20F3N3O4 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2-(2-methylpropyl)-1,3-dioxo-N-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]isoindole-5-carboxamide |
| SMILES | CC(C)CN1C(=O)c2ccc(C(=O)NCc3cccc(NC(=O)C(F)(F)F)c3)cc2C1=O |
| InChI | InChI=1S/C22H20F3N3O4/c1-12(2)11-28-19(30)16-7-6-14(9-17(16)20(28)31)18(29)26-10-13-4-3-5-15(8-13)27-21(32)22(23,24)25/h3-9,12H,10-11H2,1-2H3,(H,26,29)(H,27,32) |
| InChIKey | ZLOYYIZCGJWMJZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|