C16H17FN2O3 — CID 77080089
2-(4-fluorophenyl)-2-hydroxy-N-[3-(2-oxo-1-pyridinyl)propyl]acetamide (PubChem CID 77080089) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-hydroxy-N-[3-(2-oxo-1-pyridinyl)propyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-2-hydroxy-N-[3-(2-oxo-1-pyridinyl)propyl]acetamide |
|---|---|
| PubChem CID | 77080089 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-(4-fluorophenyl)-2-hydroxy-N-[3-(2-oxo-1-pyridinyl)propyl]acetamide |
| SMILES | O=C(NCCCn1ccccc1=O)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FN2O3/c17-13-7-5-12(6-8-13)15(21)16(22)18-9-3-11-19-10-2-1-4-14(19)20/h1-2,4-8,10,15,21H,3,9,11H2,(H,18,22) |
| InChIKey | MFIAPUUPHLMCKD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|