C24H34FN5O2 — CID 111312414
1-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine (PubChem CID 111312414) has the molecular formula C24H34FN5O2 and a molecular weight of 443.57 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine |
|---|---|
| PubChem CID | 111312414 |
| Molecular Formula | C24H34FN5O2 |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccc(F)cc1)N1CCOCC1)NCCCCn1ccccc1=O |
| InChI | InChI=1S/C24H34FN5O2/c1-2-26-24(27-12-4-6-14-30-13-5-3-7-23(30)31)28-19-22(29-15-17-32-18-16-29)20-8-10-21(25)11-9-20/h3,5,7-11,13,22H,2,4,6,12,14-19H2,1H3,(H2,26,27,28) |
| InChIKey | IHVKERZXPPDZKN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|