C23H38FIN6O2 — CID 111312411
1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]guanidine;hydroiodide (PubChem CID 111312411) has the molecular formula C23H38FIN6O2 and a molecular weight of 576.50 g/mol. Its IUPAC name is 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111312411 |
| Molecular Formula | C23H38FIN6O2 |
| Molecular Weight | 576.50 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-3-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(F)cc1)N1CCOCC1)NCCN1CCN(C(C)=O)CC1.I |
| InChI | InChI=1S/C23H37FN6O2.HI/c1-3-25-23(26-8-9-28-10-12-29(13-11-28)19(2)31)27-18-22(30-14-16-32-17-15-30)20-4-6-21(24)7-5-20;/h4-7,22H,3,8-18H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | GAVMGSHQLLKLBB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|