C18H19FN2O2 — CID 103598831
3-(4-fluorophenyl)-N-[4-(2-oxo-1-pyridinyl)butyl]prop-2-enamide (PubChem CID 103598831) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[4-(2-oxo-1-pyridinyl)butyl]prop-2-enamide.
| Compound Name | 3-(4-fluorophenyl)-N-[4-(2-oxo-1-pyridinyl)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 103598831 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[4-(2-oxo-1-pyridinyl)butyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(F)cc1)NCCCCn1ccccc1=O |
| InChI | InChI=1S/C18H19FN2O2/c19-16-9-6-15(7-10-16)8-11-17(22)20-12-2-4-14-21-13-3-1-5-18(21)23/h1,3,5-11,13H,2,4,12,14H2,(H,20,22) |
| InChIKey | FSCQXVYLCNDAOX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|