C19H16FN3O3 — CID 121034389
(E)-3-(4-fluorophenyl)-N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]prop-2-enamide (PubChem CID 121034389) has the molecular formula C19H16FN3O3 and a molecular weight of 353.35 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 121034389 |
| Molecular Formula | C19H16FN3O3 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)NCCn1nc(-c2ccco2)ccc1=O |
| InChI | InChI=1S/C19H16FN3O3/c20-15-6-3-14(4-7-15)5-9-18(24)21-11-12-23-19(25)10-8-16(22-23)17-2-1-13-26-17/h1-10,13H,11-12H2,(H,21,24)/b9-5+ |
| InChIKey | HIMHIHPJQDLKRH-WEVVVXLNSA-N |
| XLogP | 2.47 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|