C18H17N3O3S — CID 121034366
N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]-2-methylsulfanylbenzamide (PubChem CID 121034366) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]-2-methylsulfanylbenzamide.
| Compound Name | N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 121034366 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]-2-methylsulfanylbenzamide |
| SMILES | CSc1ccccc1C(=O)NCCn1nc(-c2ccco2)ccc1=O |
| InChI | InChI=1S/C18H17N3O3S/c1-25-16-7-3-2-5-13(16)18(23)19-10-11-21-17(22)9-8-14(20-21)15-6-4-12-24-15/h2-9,12H,10-11H2,1H3,(H,19,23) |
| InChIKey | KRSFADRWDIXKNE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |