C21H23N3O5 — CID 16905538
3,4-diethoxy-N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]benzamide (PubChem CID 16905538) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 3,4-diethoxy-N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16905538 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 3,4-diethoxy-N-[2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]ethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCCn2nc(-c3ccco3)ccc2=O)cc1OCC |
| InChI | InChI=1S/C21H23N3O5/c1-3-27-18-9-7-15(14-19(18)28-4-2)21(26)22-11-12-24-20(25)10-8-16(23-24)17-6-5-13-29-17/h5-10,13-14H,3-4,11-12H2,1-2H3,(H,22,26) |
| InChIKey | RVPXLJHPCYCMAF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |