C23H25N3O4 — CID 41240868
3,4-diethoxy-N-[2-(6-oxo-3-phenylpyridazin-1-yl)ethyl]benzamide (PubChem CID 41240868) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3,4-diethoxy-N-[2-(6-oxo-3-phenylpyridazin-1-yl)ethyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[2-(6-oxo-3-phenylpyridazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 41240868 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 3,4-diethoxy-N-[2-(6-oxo-3-phenylpyridazin-1-yl)ethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCCn2nc(-c3ccccc3)ccc2=O)cc1OCC |
| InChI | InChI=1S/C23H25N3O4/c1-3-29-20-12-10-18(16-21(20)30-4-2)23(28)24-14-15-26-22(27)13-11-19(25-26)17-8-6-5-7-9-17/h5-13,16H,3-4,14-15H2,1-2H3,(H,24,28) |
| InChIKey | HFIQXWHWTYRMRQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |