C21H20IN3O3 — CID 41241225
N-[2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-4-iodobenzamide (PubChem CID 41241225) has the molecular formula C21H20IN3O3 and a molecular weight of 489.31 g/mol. Its IUPAC name is N-[2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-4-iodobenzamide.
| Compound Name | N-[2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 41241225 |
| Molecular Formula | C21H20IN3O3 |
| Molecular Weight | 489.31 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | N-[2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-4-iodobenzamide |
| SMILES | CCOc1ccc(-c2ccc(=O)n(CCNC(=O)c3ccc(I)cc3)n2)cc1 |
| InChI | InChI=1S/C21H20IN3O3/c1-2-28-18-9-5-15(6-10-18)19-11-12-20(26)25(24-19)14-13-23-21(27)16-3-7-17(22)8-4-16/h3-12H,2,13-14H2,1H3,(H,23,27) |
| InChIKey | YUBXSDLIUCWJRD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|