C21H18F3N3O3 — CID 18569648
N-[2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 18569648) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is N-[2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 18569648 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-[2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(-c2ccc(=O)n(CCNC(=O)c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C21H18F3N3O3/c1-30-17-8-4-14(5-9-17)18-10-11-19(28)27(26-18)13-12-25-20(29)15-2-6-16(7-3-15)21(22,23)24/h2-11H,12-13H2,1H3,(H,25,29) |
| InChIKey | FIVHOTZIPOLQFF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |