C28H25N3O4 — CID 121033526
N-[2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-2-(4-methylbenzoyl)benzamide (PubChem CID 121033526) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is N-[2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-2-(4-methylbenzoyl)benzamide.
| Compound Name | N-[2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-2-(4-methylbenzoyl)benzamide |
|---|---|
| PubChem CID | 121033526 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N-[2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]ethyl]-2-(4-methylbenzoyl)benzamide |
| SMILES | COc1ccc(-c2ccc(=O)n(CCNC(=O)c3ccccc3C(=O)c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C28H25N3O4/c1-19-7-9-21(10-8-19)27(33)23-5-3-4-6-24(23)28(34)29-17-18-31-26(32)16-15-25(30-31)20-11-13-22(35-2)14-12-20/h3-16H,17-18H2,1-2H3,(H,29,34) |
| InChIKey | OWYBTLZJJDECJN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |