C13H12F4N2O2 — CID 108932622
(E)-3-(4-fluorophenyl)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]prop-2-enamide (PubChem CID 108932622) has the molecular formula C13H12F4N2O2 and a molecular weight of 304.24 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108932622 |
| Molecular Formula | C13H12F4N2O2 |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)NCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H12F4N2O2/c14-10-4-1-9(2-5-10)3-6-11(20)18-7-8-19-12(21)13(15,16)17/h1-6H,7-8H2,(H,18,20)(H,19,21)/b6-3+ |
| InChIKey | YAWWGBAIZHKAJP-ZZXKWVIFSA-N |
| XLogP | 1.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|