C14H17FN2O — CID 55100390
(E)-N-[2-(cyclopropylamino)ethyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 55100390) has the molecular formula C14H17FN2O and a molecular weight of 248.30 g/mol. Its IUPAC name is (E)-N-[2-(cyclopropylamino)ethyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(cyclopropylamino)ethyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55100390 |
| Molecular Formula | C14H17FN2O |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (E)-N-[2-(cyclopropylamino)ethyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)NCCNC1CC1 |
| InChI | InChI=1S/C14H17FN2O/c15-12-4-1-11(2-5-12)3-8-14(18)17-10-9-16-13-6-7-13/h1-5,8,13,16H,6-7,9-10H2,(H,17,18)/b8-3+ |
| InChIKey | DKEORFQNNZDTKH-FPYGCLRLSA-N |
| XLogP | 1.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|