C20H21FN2O2 — CID 124727193
(2S)-2-(4-fluorophenyl)-3-hydroxy-N-(3-indol-1-ylpropyl)propanamide (PubChem CID 124727193) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is (2S)-2-(4-fluorophenyl)-3-hydroxy-N-(3-indol-1-ylpropyl)propanamide.
| Compound Name | (2S)-2-(4-fluorophenyl)-3-hydroxy-N-(3-indol-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 124727193 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (2S)-2-(4-fluorophenyl)-3-hydroxy-N-(3-indol-1-ylpropyl)propanamide |
| SMILES | O=C(NCCCn1ccc2ccccc21)[C@H](CO)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN2O2/c21-17-8-6-15(7-9-17)18(14-24)20(25)22-11-3-12-23-13-10-16-4-1-2-5-19(16)23/h1-2,4-10,13,18,24H,3,11-12,14H2,(H,22,25)/t18-/m1/s1 |
| InChIKey | CPOJRVJTNXJGJB-GOSISDBHSA-N |
| XLogP | 3.06 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|