C14H14F4N2O — CID 103732076
2,2,3,3-tetrafluoro-N-(3-indol-1-ylpropyl)propanamide (PubChem CID 103732076) has the molecular formula C14H14F4N2O and a molecular weight of 302.27 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(3-indol-1-ylpropyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(3-indol-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 103732076 |
| Molecular Formula | C14H14F4N2O |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(3-indol-1-ylpropyl)propanamide |
| SMILES | O=C(NCCCn1ccc2ccccc21)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H14F4N2O/c15-12(16)14(17,18)13(21)19-7-3-8-20-9-6-10-4-1-2-5-11(10)20/h1-2,4-6,9,12H,3,7-8H2,(H,19,21) |
| InChIKey | RYVXKDJUJPLJFU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|