C23H28FN5O — CID 111342109
2-[(4-fluorophenyl)methyl]-3-[[N-(3-indol-1-ylpropyl)-N'-methylcarbamimidoyl]amino]propanamide (PubChem CID 111342109) has the molecular formula C23H28FN5O and a molecular weight of 409.51 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-3-[[N-(3-indol-1-ylpropyl)-N'-methylcarbamimidoyl]amino]propanamide.
| Compound Name | 2-[(4-fluorophenyl)methyl]-3-[[N-(3-indol-1-ylpropyl)-N'-methylcarbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111342109 |
| Molecular Formula | C23H28FN5O |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-3-[[N-(3-indol-1-ylpropyl)-N'-methylcarbamimidoyl]amino]propanamide |
| SMILES | C/N=C(/NCCCn1ccc2ccccc21)NCC(Cc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C23H28FN5O/c1-26-23(27-12-4-13-29-14-11-18-5-2-3-6-21(18)29)28-16-19(22(25)30)15-17-7-9-20(24)10-8-17/h2-3,5-11,14,19H,4,12-13,15-16H2,1H3,(H2,25,30)(H2,26,27,28) |
| InChIKey | MBRYRTRIUMYDIK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|