C22H28N4O2 — CID 111201296
1-[(3,4-dimethoxyphenyl)methyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine (PubChem CID 111201296) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111201296 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine |
| SMILES | C/N=C(/NCCCn1ccc2ccccc21)NCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H28N4O2/c1-23-22(25-16-17-9-10-20(27-2)21(15-17)28-3)24-12-6-13-26-14-11-18-7-4-5-8-19(18)26/h4-5,7-11,14-15H,6,12-13,16H2,1-3H3,(H2,23,24,25) |
| InChIKey | SLNBEFWXMHYOQG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|