C24H28N6 — CID 111341837
1-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine (PubChem CID 111341837) has the molecular formula C24H28N6 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine.
| Compound Name | 1-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111341837 |
| Molecular Formula | C24H28N6 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 1-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-3-(3-indol-1-ylpropyl)-2-methylguanidine |
| SMILES | C/N=C(/NCCCn1ccc2ccccc21)NCc1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C24H28N6/c1-25-24(27-12-4-14-30-15-11-22-5-2-3-6-23(22)30)28-17-20-7-9-21(10-8-20)18-29-16-13-26-19-29/h2-3,5-11,13,15-16,19H,4,12,14,17-18H2,1H3,(H2,25,27,28) |
| InChIKey | XALISJUVOUTFSJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|