C23H29FN2O3 — CID 7324264
(2S)-N-[(2R)-2-ethylhexyl]-3-(4-fluorophenyl)-2-(5-methyl-2-oxo-1-pyridinyl)-3-oxopropanamide (PubChem CID 7324264) has the molecular formula C23H29FN2O3 and a molecular weight of 400.49 g/mol. Its IUPAC name is (2S)-N-[(2R)-2-ethylhexyl]-3-(4-fluorophenyl)-2-(5-methyl-2-oxo-1-pyridinyl)-3-oxopropanamide.
| Compound Name | (2S)-N-[(2R)-2-ethylhexyl]-3-(4-fluorophenyl)-2-(5-methyl-2-oxo-1-pyridinyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 7324264 |
| Molecular Formula | C23H29FN2O3 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (2S)-N-[(2R)-2-ethylhexyl]-3-(4-fluorophenyl)-2-(5-methyl-2-oxo-1-pyridinyl)-3-oxopropanamide |
| SMILES | CCCC[C@@H](CC)CNC(=O)[C@H](C(=O)c1ccc(F)cc1)n1cc(C)ccc1=O |
| InChI | InChI=1S/C23H29FN2O3/c1-4-6-7-17(5-2)14-25-23(29)21(26-15-16(3)8-13-20(26)27)22(28)18-9-11-19(24)12-10-18/h8-13,15,17,21H,4-7,14H2,1-3H3,(H,25,29)/t17-,21+/m1/s1 |
| InChIKey | DWCVXBWFVNIXHI-UTKZUKDTSA-N |
| XLogP | 4.05 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|