C19H14ClFN2O4 — CID 7317685
(2S)-2-(5-chloro-2-oxo-1-pyridinyl)-3-(4-fluorophenyl)-N-(furan-2-ylmethyl)-3-oxopropanamide (PubChem CID 7317685) has the molecular formula C19H14ClFN2O4 and a molecular weight of 388.78 g/mol. Its IUPAC name is (2S)-2-(5-chloro-2-oxo-1-pyridinyl)-3-(4-fluorophenyl)-N-(furan-2-ylmethyl)-3-oxopropanamide.
| Compound Name | (2S)-2-(5-chloro-2-oxo-1-pyridinyl)-3-(4-fluorophenyl)-N-(furan-2-ylmethyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 7317685 |
| Molecular Formula | C19H14ClFN2O4 |
| Molecular Weight | 388.78 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | (2S)-2-(5-chloro-2-oxo-1-pyridinyl)-3-(4-fluorophenyl)-N-(furan-2-ylmethyl)-3-oxopropanamide |
| SMILES | O=C(NCc1ccco1)[C@H](C(=O)c1ccc(F)cc1)n1cc(Cl)ccc1=O |
| InChI | InChI=1S/C19H14ClFN2O4/c20-13-5-8-16(24)23(11-13)17(18(25)12-3-6-14(21)7-4-12)19(26)22-10-15-2-1-9-27-15/h1-9,11,17H,10H2,(H,22,26)/t17-/m0/s1 |
| InChIKey | YUBIEYTUZUVOJI-KRWDZBQOSA-N |
| XLogP | 2.97 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.78 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|