C20H17ClFNO2 — CID 110296194
N-[(4-chlorophenyl)methyl]-2-(4-fluorophenyl)-3-(furan-2-yl)propanamide (PubChem CID 110296194) has the molecular formula C20H17ClFNO2 and a molecular weight of 357.81 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(4-fluorophenyl)-3-(furan-2-yl)propanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(4-fluorophenyl)-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 110296194 |
| Molecular Formula | C20H17ClFNO2 |
| Molecular Weight | 357.81 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(4-fluorophenyl)-3-(furan-2-yl)propanamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)C(Cc1ccco1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17ClFNO2/c21-16-7-3-14(4-8-16)13-23-20(24)19(12-18-2-1-11-25-18)15-5-9-17(22)10-6-15/h1-11,19H,12-13H2,(H,23,24) |
| InChIKey | UPBKTOZWSHFNMB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.81 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |