C17H18ClNO4S — CID 110296620
2-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)propanamide (PubChem CID 110296620) has the molecular formula C17H18ClNO4S and a molecular weight of 367.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)propanamide.
| Compound Name | 2-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 110296620 |
| Molecular Formula | C17H18ClNO4S |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)-3-(furan-2-yl)propanamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)C(Cc1ccco1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClNO4S/c18-13-5-3-12(4-6-13)16(10-15-2-1-8-23-15)17(20)19-14-7-9-24(21,22)11-14/h1-6,8,14,16H,7,9-11H2,(H,19,20) |
| InChIKey | MWEDLYPKBNGHCJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |