C13H19ClN2O3S — CID 119670194
3-amino-N-(1,1-dioxothiolan-3-yl)-2-phenylpropanamide;hydrochloride (PubChem CID 119670194) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is 3-amino-N-(1,1-dioxothiolan-3-yl)-2-phenylpropanamide;hydrochloride.
| Compound Name | 3-amino-N-(1,1-dioxothiolan-3-yl)-2-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119670194 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3-amino-N-(1,1-dioxothiolan-3-yl)-2-phenylpropanamide;hydrochloride |
| SMILES | Cl.NCC(C(=O)NC1CCS(=O)(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C13H18N2O3S.ClH/c14-8-12(10-4-2-1-3-5-10)13(16)15-11-6-7-19(17,18)9-11;/h1-5,11-12H,6-9,14H2,(H,15,16);1H |
| InChIKey | XETKOGIBPREMNB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |