C22H22FNO5 — CID 110296237
2-(4-fluorophenyl)-3-(furan-2-yl)-N-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 110296237) has the molecular formula C22H22FNO5 and a molecular weight of 399.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-(furan-2-yl)-N-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | 2-(4-fluorophenyl)-3-(furan-2-yl)-N-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 110296237 |
| Molecular Formula | C22H22FNO5 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-(4-fluorophenyl)-3-(furan-2-yl)-N-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(NC(=O)C(Cc2ccco2)c2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22FNO5/c1-26-19-11-16(12-20(27-2)21(19)28-3)24-22(25)18(13-17-5-4-10-29-17)14-6-8-15(23)9-7-14/h4-12,18H,13H2,1-3H3,(H,24,25) |
| InChIKey | NAGRHKKWICYSBJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |