C21H20FNO4 — CID 110296223
N-(2,5-dimethoxyphenyl)-2-(4-fluorophenyl)-3-(furan-2-yl)propanamide (PubChem CID 110296223) has the molecular formula C21H20FNO4 and a molecular weight of 369.39 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-(4-fluorophenyl)-3-(furan-2-yl)propanamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-(4-fluorophenyl)-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 110296223 |
| Molecular Formula | C21H20FNO4 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-(4-fluorophenyl)-3-(furan-2-yl)propanamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(Cc2ccco2)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H20FNO4/c1-25-16-9-10-20(26-2)19(13-16)23-21(24)18(12-17-4-3-11-27-17)14-5-7-15(22)8-6-14/h3-11,13,18H,12H2,1-2H3,(H,23,24) |
| InChIKey | CMIBRLSODGXDSZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |