C22H20F2N2O3 — CID 110615557
N-[1-(2-fluoroanilino)-1-oxopropan-2-yl]-2-(4-fluorophenyl)-3-(furan-2-yl)propanamide (PubChem CID 110615557) has the molecular formula C22H20F2N2O3 and a molecular weight of 398.41 g/mol. Its IUPAC name is N-[1-(2-fluoroanilino)-1-oxopropan-2-yl]-2-(4-fluorophenyl)-3-(furan-2-yl)propanamide.
| Compound Name | N-[1-(2-fluoroanilino)-1-oxopropan-2-yl]-2-(4-fluorophenyl)-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 110615557 |
| Molecular Formula | C22H20F2N2O3 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[1-(2-fluoroanilino)-1-oxopropan-2-yl]-2-(4-fluorophenyl)-3-(furan-2-yl)propanamide |
| SMILES | CC(NC(=O)C(Cc1ccco1)c1ccc(F)cc1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C22H20F2N2O3/c1-14(21(27)26-20-7-3-2-6-19(20)24)25-22(28)18(13-17-5-4-12-29-17)15-8-10-16(23)11-9-15/h2-12,14,18H,13H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | FBNFKHCLKJSZQV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |