C16H16FNO3 — CID 110298073
5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-5-oxopentanamide (PubChem CID 110298073) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-5-oxopentanamide.
| Compound Name | 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-5-oxopentanamide |
|---|---|
| PubChem CID | 110298073 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-5-oxopentanamide |
| SMILES | O=C(CCCC(=O)c1ccc(F)cc1)NCc1ccco1 |
| InChI | InChI=1S/C16H16FNO3/c17-13-8-6-12(7-9-13)15(19)4-1-5-16(20)18-11-14-3-2-10-21-14/h2-3,6-10H,1,4-5,11H2,(H,18,20) |
| InChIKey | CENVGEFIKMGCHM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |