C16H18N2O4 — CID 776917
(2S)-2-(1,3-dioxoisoindol-2-yl)-N-[[(2S)-oxolan-2-yl]methyl]propanamide (PubChem CID 776917) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[[(2S)-oxolan-2-yl]methyl]propanamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[[(2S)-oxolan-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 776917 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[[(2S)-oxolan-2-yl]methyl]propanamide |
| SMILES | C[C@@H](C(=O)NC[C@@H]1CCCO1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H18N2O4/c1-10(14(19)17-9-11-5-4-8-22-11)18-15(20)12-6-2-3-7-13(12)16(18)21/h2-3,6-7,10-11H,4-5,8-9H2,1H3,(H,17,19)/t10-,11-/m0/s1 |
| InChIKey | RGYPJMHFLPPUMD-QWRGUYRKSA-N |
| XLogP | 0.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|