C17H22Br2N2O4 — CID 98142855
(2R)-2-[(1S,2R,6S,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-[[(2S)-oxolan-2-yl]methyl]propanamide (PubChem CID 98142855) has the molecular formula C17H22Br2N2O4 and a molecular weight of 478.18 g/mol. Its IUPAC name is (2R)-2-[(1S,2R,6S,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-[[(2S)-oxolan-2-yl]methyl]propanamide.
| Compound Name | (2R)-2-[(1S,2R,6S,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-[[(2S)-oxolan-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 98142855 |
| Molecular Formula | C17H22Br2N2O4 |
| Molecular Weight | 478.18 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | (2R)-2-[(1S,2R,6S,7S,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-[[(2S)-oxolan-2-yl]methyl]propanamide |
| SMILES | C[C@H](C(=O)NC[C@@H]1CCCO1)N1C(=O)[C@@H]2[C@@H]3C[C@H]([C@H](Br)[C@@H]3Br)[C@@H]2C1=O |
| InChI | InChI=1S/C17H22Br2N2O4/c1-7(15(22)20-6-8-3-2-4-25-8)21-16(23)11-9-5-10(12(11)17(21)24)14(19)13(9)18/h7-14H,2-6H2,1H3,(H,20,22)/t7-,8+,9+,10+,11-,12+,13-,14+/m1/s1 |
| InChIKey | RGFIBPKBUNYJOT-JCIWJHOISA-N |
| XLogP | 1.45 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|