C21H22Br2N2O4 — CID 3343025
4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 3343025) has the molecular formula C21H22Br2N2O4 and a molecular weight of 526.23 g/mol. Its IUPAC name is 4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3343025 |
| Molecular Formula | C21H22Br2N2O4 |
| Molecular Weight | 526.23 g/mol |
| Exact Mass | 523.99 |
| IUPAC Name | 4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCO1)c1ccc(N2C(=O)C3C4CC(C(Br)C4Br)C3C2=O)cc1 |
| InChI | InChI=1S/C21H22Br2N2O4/c22-17-13-8-14(18(17)23)16-15(13)20(27)25(21(16)28)11-5-3-10(4-6-11)19(26)24-9-12-2-1-7-29-12/h3-6,12-18H,1-2,7-9H2,(H,24,26) |
| InChIKey | UTWBUOTXVVOIPF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|