C14H17Br2NO3 — CID 98140638
(1S,2S,6R,7S,8S,9R)-8,9-dibromo-4-[[(2R)-oxolan-2-yl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 98140638) has the molecular formula C14H17Br2NO3 and a molecular weight of 407.10 g/mol. Its IUPAC name is (1S,2S,6R,7S,8S,9R)-8,9-dibromo-4-[[(2R)-oxolan-2-yl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2S,6R,7S,8S,9R)-8,9-dibromo-4-[[(2R)-oxolan-2-yl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 98140638 |
| Molecular Formula | C14H17Br2NO3 |
| Molecular Weight | 407.10 g/mol |
| Exact Mass | 404.96 |
| IUPAC Name | (1S,2S,6R,7S,8S,9R)-8,9-dibromo-4-[[(2R)-oxolan-2-yl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H]3C[C@H]([C@H](Br)[C@@H]3Br)[C@@H]2C(=O)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C14H17Br2NO3/c15-11-7-4-8(12(11)16)10-9(7)13(18)17(14(10)19)5-6-2-1-3-20-6/h6-12H,1-5H2/t6-,7+,8+,9-,10+,11-,12+/m1/s1 |
| InChIKey | ASXVCDWGBDBHTH-HSBJXMDPSA-N |
| XLogP | 1.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.10 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|