C9H14N2O3 — CID 64982518
1-(oxolan-2-ylmethyl)piperazine-2,6-dione (PubChem CID 64982518) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)piperazine-2,6-dione.
| Compound Name | 1-(oxolan-2-ylmethyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 64982518 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)piperazine-2,6-dione |
| SMILES | O=C1CNCC(=O)N1CC1CCCO1 |
| InChI | InChI=1S/C9H14N2O3/c12-8-4-10-5-9(13)11(8)6-7-2-1-3-14-7/h7,10H,1-6H2 |
| InChIKey | HCDWEUIFTQLLEI-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|