C9H14N2O3 — CID 103601172
3-(oxan-2-ylmethyl)imidazolidine-2,4-dione (PubChem CID 103601172) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-(oxan-2-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | 3-(oxan-2-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 103601172 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 3-(oxan-2-ylmethyl)imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CC1CCCCO1 |
| InChI | InChI=1S/C9H14N2O3/c12-8-5-10-9(13)11(8)6-7-3-1-2-4-14-7/h7H,1-6H2,(H,10,13) |
| InChIKey | BQPSPNUHTCMCIK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|