C22H24N2O3 — CID 56728960
(2S)-2-(3-oxo-1H-isoindol-2-yl)-N-(oxolan-2-ylmethyl)-3-phenylpropanamide (PubChem CID 56728960) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is (2S)-2-(3-oxo-1H-isoindol-2-yl)-N-(oxolan-2-ylmethyl)-3-phenylpropanamide.
| Compound Name | (2S)-2-(3-oxo-1H-isoindol-2-yl)-N-(oxolan-2-ylmethyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 56728960 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (2S)-2-(3-oxo-1H-isoindol-2-yl)-N-(oxolan-2-ylmethyl)-3-phenylpropanamide |
| SMILES | O=C(NCC1CCCO1)[C@H](Cc1ccccc1)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C22H24N2O3/c25-21(23-14-18-10-6-12-27-18)20(13-16-7-2-1-3-8-16)24-15-17-9-4-5-11-19(17)22(24)26/h1-5,7-9,11,18,20H,6,10,12-15H2,(H,23,25)/t18?,20-/m0/s1 |
| InChIKey | KQKYGRDZQXVQHU-IJHRGXPZSA-N |
| XLogP | 2.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |